EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752722 - zatosetron maleate
| Formula | C4H4O4.C19H25ClN2O2 |
| Net Charge | 0 |
| Average Mass | 464.946 |
| Monoisotopic Mass | 464.17141 |
| SMILES | O=C(O)/C=C\C(=O)O.[H][C@]12CC[C@]([H])(C[C@H](NC(=O)c3cc(Cl)cc4c3OC(C)(C)C4)C1)N2C |
| InChI | InChI=1S/C19H25ClN2O2.C4H4O4/c1-19(2)10-11-6-12(20)7-16(17(11)24-19)18(23)21-13-8-14-4-5-15(9-13)22(14)3;5-3(6)1-2-4(7)8/h6-7,13-15H,4-5,8-10H2,1-3H3,(H,21,23);1-2H,(H,5,6)(H,7,8)/b;2-1-/t13-,14+,15-; |
| InChIKey | HAFQATMFFHYNPN-QRPZPOMXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zatosetron maleate (CHEBI:752722) is a tropane alkaloid (CHEBI:37332) |
| Synonyms | Source |
|---|---|
| LY-277359 MALEATE | ChEMBL |
| LY277359 MALEATE | ChEMBL |
| Zatosetron maleate | ChEMBL |