EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10O2 |
| Net Charge | 0 |
| Average Mass | 198.221 |
| Monoisotopic Mass | 198.06808 |
| SMILES | O=C1CCc2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C13H10O2/c14-13-8-6-11-10-4-2-1-3-9(10)5-7-12(11)15-13/h1-5,7H,6,8H2 |
| InChIKey | ISFPDBUKMJDAJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Sir2 inhibitor An EC 3.5.1.98 (histone deacetylase) inhibitor that interferes with the action of Sir2. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| splitomicin (CHEBI:75272) has role platelet aggregation inhibitor (CHEBI:50427) |
| splitomicin (CHEBI:75272) has role Sir2 inhibitor (CHEBI:71181) |
| splitomicin (CHEBI:75272) is a benzochromenone (CHEBI:64986) |
| splitomicin (CHEBI:75272) is a naphtho-α-pyrone (CHEBI:146280) |
| splitomicin (CHEBI:75272) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 1,2-dihydro-3H-benzo[f]chromen-3-one |
| Synonym | Source |
|---|---|
| 1,2-dihydro-3H-naphtho[2,1-b]-pyran-3-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| KR20120128451 | Patent |
| LSM-2607 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:161649 | Reaxys |
| Citations |
|---|