EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO5 |
| Net Charge | 0 |
| Average Mass | 345.395 |
| Monoisotopic Mass | 345.15762 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(CCOC)[C@]([H])(C4)[C@]3(O)CCC2=O |
| InChI | InChI=1S/C19H23NO5/c1-24-9-8-20-7-6-18-15-11-2-3-12(21)16(15)25-17(18)13(22)4-5-19(18,23)14(20)10-11/h2-3,14,17,21,23H,4-10H2,1H3/t14-,17+,18+,19-/m1/s1 |
| InChIKey | PBGIBLLOMGURPS-GRGSLBFTSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| semorphone (CHEBI:752716) is a phenanthrenes (CHEBI:25961) |
| INNs | Source |
|---|---|
| semorfona | WHO MedNet |
| semorphone | WHO MedNet |
| Synonyms | Source |
|---|---|
| MR-2264 | ChEMBL |
| MR2264 | ChEMBL |
| N-(2-methoxyethyl)noroxymorphone | ChEMBL |