EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C15H15FN4O |
| Net Charge | 0 |
| Average Mass | 322.771 |
| Monoisotopic Mass | 322.09967 |
| SMILES | Cc1nn(C)c2c1C(c1ccccc1F)=NCC(=O)N2C.Cl |
| InChI | InChI=1S/C15H15FN4O.ClH/c1-9-13-14(10-6-4-5-7-11(10)16)17-8-12(21)19(2)15(13)20(3)18-9;/h4-7H,8H2,1-3H3;1H |
| InChIKey | NJERAXSSDSHLGE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zolazepam hydrochloride (CHEBI:752713) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| CI-716 | ChEMBL |
| Zolazepam hcl | ChEMBL |
| Zolazepam hydrochloride | ChEMBL |
| Citations |
|---|