EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752699 - chlorproguanil hydrochloride
| Formula | HCl.C11H15Cl2N5 |
| Net Charge | 0 |
| Average Mass | 324.643 |
| Monoisotopic Mass | 323.04713 |
| SMILES | CC(C)NC(=N)NC(=N)Nc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H15Cl2N5.ClH/c1-6(2)16-10(14)18-11(15)17-7-3-4-8(12)9(13)5-7;/h3-6H,1-2H3,(H5,14,15,16,17,18);1H |
| InChIKey | SVJMILFDDBKCGG-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorproguanil hydrochloride (CHEBI:752699) is a guanidines (CHEBI:24436) |
| Synonyms | Source |
|---|---|
| Chlorproguanil hcl | ChEMBL |
| Chlorproguanil hydrochloride | ChEMBL |
| Lapudrine | ChEMBL |
| Proguanil related compound f | ChEMBL |