EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:752680 - rosterolone
| Formula | C23H38O2 |
| Net Charge | 0 |
| Average Mass | 346.555 |
| Monoisotopic Mass | 346.28718 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@@](O)(CCC)[C@@]4(C)CC[C@]3([H])[C@@]1(C)[C@@H](C)CC(=O)C2 |
| InChI | InChI=1S/C23H38O2/c1-5-10-23(25)12-9-19-18-7-6-16-14-17(24)13-15(2)22(16,4)20(18)8-11-21(19,23)3/h15-16,18-20,25H,5-14H2,1-4H3/t15-,16-,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | IMFNBOMNWHWKQD-MXENSADDSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosterolone (CHEBI:752680) has role androgen (CHEBI:50113) |
| rosterolone (CHEBI:752680) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| rosterolona | WHO MedNet |
| rosterolone | WHO MedNet |