EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5DFNO2 |
| Net Charge | 0 |
| Average Mass | 108.090 |
| Monoisotopic Mass | 108.04453 |
| SMILES | [2H][C@@](N)(CF)C(=O)O |
| InChI | InChI=1S/C3H6FNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7)/t2-/m1/s1/i2D |
| InChIKey | UYTSRQMXRROFPU-LIIDHCAMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fludalanine (CHEBI:752627) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| fludalanina | WHO MedNet |
| fludalanine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-fluoro-d-alanine-2-d | ChEMBL |
| D-alanine-2-d, 3-fluoro- | ChEMBL |