EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752622 - levocarnitine propionate hydrochloride
| Formula | Cl.C10H20NO4 |
| Net Charge | 0 |
| Average Mass | 253.726 |
| Monoisotopic Mass | 253.10809 |
| SMILES | CCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C10H19NO4.ClH/c1-5-10(14)15-8(6-9(12)13)7-11(2,3)4;/h8H,5-7H2,1-4H3;1H/t8-;/m1./s1 |
| InChIKey | KTFMPDDJYRFWQE-DDWIOCJRSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levocarnitine propionate hydrochloride (CHEBI:752622) is a O-acylcarnitine (CHEBI:17387) |
| Synonyms | Source |
|---|---|
| NSC-759826 | ChEMBL |
| Propionyl-l-carnitine chloride | ChEMBL |
| ST 261 | ChEMBL |
| ST-261 | ChEMBL |
| Brand Name | Source |
|---|---|
| Dromos | ChEMBL |