EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752618 - levonantradol hydrochloride
| Formula | HCl.C27H35NO4 |
| Net Charge | 0 |
| Average Mass | 474.041 |
| Monoisotopic Mass | 473.23329 |
| SMILES | Cl.[H][C@@]12C[C@H](O)CC[C@@]1([H])[C@H](C)Nc1cc(O[C@H](C)CCCc3ccccc3)cc(OC(C)=O)c12 |
| InChI | InChI=1S/C27H35NO4.ClH/c1-17(8-7-11-20-9-5-4-6-10-20)31-22-15-25-27(26(16-22)32-19(3)29)24-14-21(30)12-13-23(24)18(2)28-25;/h4-6,9-10,15-18,21,23-24,28,30H,7-8,11-14H2,1-3H3;1H/t17-,18+,21-,23+,24-;/m1./s1 |
| InChIKey | NSOGAHPJIFTUHV-YINRMENDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levonantradol hydrochloride (CHEBI:752618) is a phenanthridines (CHEBI:51245) |
| Synonyms | Source |
|---|---|
| CP-50,556-1 | ChEMBL |
| CP-50556-1 | ChEMBL |
| Levonantradol hcl | ChEMBL |
| Levonantradol hydrochloride | ChEMBL |
| NSC-331615 | ChEMBL |