EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O2 |
| Net Charge | 0 |
| Average Mass | 348.486 |
| Monoisotopic Mass | 348.20893 |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28O2/c1-16(14-17-6-8-18(9-7-17)22(25)26)19-10-11-20-21(15-19)24(4,5)13-12-23(20,2)3/h6-11,14-15H,12-13H2,1-5H3,(H,25,26)/b16-14+ |
| InChIKey | FOIVPCKZDPCJJY-JQIJEIRASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. retinoic acid receptor agonist An agonist that selectively binds to and activates a retinoic acid receptor. |
| Applications: | retinoic acid receptor agonist An agonist that selectively binds to and activates a retinoic acid receptor. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arotinoid acid (CHEBI:75261) has role antineoplastic agent (CHEBI:35610) |
| arotinoid acid (CHEBI:75261) has role retinoic acid receptor agonist (CHEBI:67198) |
| arotinoid acid (CHEBI:75261) has role teratogenic agent (CHEBI:50905) |
| arotinoid acid (CHEBI:75261) is a benzoic acids (CHEBI:22723) |
| arotinoid acid (CHEBI:75261) is a naphthalenes (CHEBI:25477) |
| arotinoid acid (CHEBI:75261) is a retinoid (CHEBI:26537) |
| IUPAC Name |
|---|
| 4-[(1E)-2-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)prop-1-en-1-yl]benzoic acid |
| Synonyms | Source |
|---|---|
| TTNPB | ChEBI |
| Ro 13-7410 | ChemIDplus |
| AGN-191183 | ChemIDplus |
| Arotinoic acid | ChemIDplus |
| CCRIS 3297 | DrugBank |
| TTNPB | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2008247 | Reaxys |
| CAS:71441-28-6 | ChemIDplus |
| CAS:71441-28-6 | KEGG COMPOUND |
| Citations |
|---|