EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O2 |
| Net Charge | 0 |
| Average Mass | 348.486 |
| Monoisotopic Mass | 348.20893 |
| SMILES | C/C(=C\c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28O2/c1-16(14-17-6-8-18(9-7-17)22(25)26)19-10-11-20-21(15-19)24(4,5)13-12-23(20,2)3/h6-11,14-15H,12-13H2,1-5H3,(H,25,26)/b16-14+ |
| InChIKey | FOIVPCKZDPCJJY-JQIJEIRASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | retinoic acid receptor agonist An agonist that selectively binds to and activates a retinoic acid receptor. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Applications: | retinoic acid receptor agonist An agonist that selectively binds to and activates a retinoic acid receptor. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arotinoid acid (CHEBI:75261) has role antineoplastic agent (CHEBI:35610) |
| arotinoid acid (CHEBI:75261) has role retinoic acid receptor agonist (CHEBI:67198) |
| arotinoid acid (CHEBI:75261) has role teratogenic agent (CHEBI:50905) |
| arotinoid acid (CHEBI:75261) is a benzoic acids (CHEBI:22723) |
| arotinoid acid (CHEBI:75261) is a naphthalenes (CHEBI:25477) |
| arotinoid acid (CHEBI:75261) is a retinoid (CHEBI:26537) |
| IUPAC Name |
|---|
| 4-[(1E)-2-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)prop-1-en-1-yl]benzoic acid |
| Synonyms | Source |
|---|---|
| AGN-191183 | ChemIDplus |
| Arotinoic acid | ChemIDplus |
| CCRIS 3297 | DrugBank |
| Ro 13-7410 | ChemIDplus |
| Ro 13-7410 | KEGG COMPOUND |
| TTNPB | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2008247 | Reaxys |
| CAS:71441-28-6 | KEGG COMPOUND |
| CAS:71441-28-6 | ChemIDplus |
| Citations |
|---|