EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34F3N3O3S |
| Net Charge | 0 |
| Average Mass | 525.637 |
| Monoisotopic Mass | 525.22730 |
| SMILES | CSc1ccccc1N(Cc1cccc(C(F)(F)F)c1)C(=O)CN(CCN(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C26H34F3N3O3S/c1-19(2)18-35-25(34)31(14-13-30(3)4)17-24(33)32(22-11-6-7-12-23(22)36-5)16-20-9-8-10-21(15-20)26(27,28)29/h6-12,15,19H,13-14,16-18H2,1-5H3 |
| InChIKey | MJOGWNMYQLVUOU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flosatidil (CHEBI:752606) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| flosatidil | WHO MedNet |