EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C28H38F3N5O2 |
| Net Charge | 0 |
| Average Mass | 649.711 |
| Monoisotopic Mass | 649.30872 |
| SMILES | COC[C@@H](c1ccc(C(F)(F)F)cc1)N1CCN(C2(C)CCN(C(=O)c3c(C)ncnc3C)CC2)C[C@@H]1C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C28H38F3N5O2.C4H4O4/c1-19-16-35(14-15-36(19)24(17-38-5)22-6-8-23(9-7-22)28(29,30)31)27(4)10-12-34(13-11-27)26(37)25-20(2)32-18-33-21(25)3;5-3(6)1-2-4(7)8/h6-9,18-19,24H,10-17H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t19-,24-;/m0./s1 |
| InChIKey | GXINKQQWHLIBJA-UCIBKFKQSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vicriviroc maleate (CHEBI:752604) has role anti-HIV agent (CHEBI:64946) |
| vicriviroc maleate (CHEBI:752604) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| Synonyms | Source |
|---|---|
| MK-4176 | ChEMBL |
| Sch417690 | ChEMBL |
| SCH 417690 | ChEMBL |
| SCH-417690 | ChEMBL |
| Vicriviroc maleate | ChEMBL |