EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C32H58N6O5 |
| Net Charge | 0 |
| Average Mass | 643.314 |
| Monoisotopic Mass | 642.42355 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C(C)C)N(C)C)C(=O)N(C)[C@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)NC(C)(C)C)C(C)C.Cl |
| InChI | InChI=1S/C32H58N6O5.ClH/c1-19(2)24(33-28(40)25(20(3)4)35(10)11)30(42)36(12)26(21(5)6)31(43)38-18-14-16-23(38)29(41)37-17-13-15-22(37)27(39)34-32(7,8)9;/h19-26H,13-18H2,1-12H3,(H,33,40)(H,34,39);1H/t22-,23-,24-,25-,26-;/m0./s1 |
| InChIKey | OOKIODJYZSVHDO-QMYFOHRPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasidotin hydrochloride (CHEBI:752599) has role antineoplastic agent (CHEBI:35610) |
| tasidotin hydrochloride (CHEBI:752599) is a peptide (CHEBI:16670) |
| Synonyms | Source |
|---|---|
| ILX-651 | ChEMBL |
| ILX651 | ChEMBL |
| Tasidotin hydrochloride | ChEMBL |