EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2S |
| Net Charge | 0 |
| Average Mass | 232.352 |
| Monoisotopic Mass | 232.10342 |
| SMILES | Cc1cccc([C@H](C)c2cnc(=S)n2)c1C |
| InChI | InChI=1S/C13H16N2S/c1-8-5-4-6-11(9(8)2)10(3)12-7-14-13(16)15-12/h4-7,10H,1-3H3,(H2,14,15,16)/t10-/m0/s1 |
| InChIKey | WQXVKEDUCPMRRI-JTQLQIEISA-N |
| Roles Classification |
|---|
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rezatomidine (CHEBI:752593) has role antispasmodic drug (CHEBI:53784) |
| rezatomidine (CHEBI:752593) is a methylbenzene (CHEBI:38975) |
| INNs | Source |
|---|---|
| rezatomidina | WHO MedNet |
| rezatomidine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Agn 203818 | ChEMBL |
| AGN-203818 | ChEMBL |
| AGN203818 | ChEMBL |
| Agn 203818 free base | ChEMBL |
| AGN-203818 FREE BASE | ChEMBL |