EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N5O6S |
| Net Charge | 0 |
| Average Mass | 463.516 |
| Monoisotopic Mass | 463.15255 |
| SMILES | Cc1cc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)sc1CC[C@@H]1CNc2nc(N)nc(=O)c2C1 |
| InChI | InChI=1S/C20H25N5O6S/c1-9-6-14(18(29)23-12(19(30)31)3-5-15(26)27)32-13(9)4-2-10-7-11-16(22-8-10)24-20(21)25-17(11)28/h6,10,12H,2-5,7-8H2,1H3,(H,23,29)(H,26,27)(H,30,31)(H4,21,22,24,25,28)/t10-,12-/m0/s1 |
| InChIKey | QXOPTIPQEVJERB-JQWIXIFHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pelitrexol (CHEBI:752590) has role antineoplastic agent (CHEBI:35610) |
| pelitrexol (CHEBI:752590) is a glutamic acid derivative (CHEBI:24315) |
| INN | Source |
|---|---|
| pelitrexol | WHO MedNet |
| Synonyms | Source |
|---|---|
| AG-2037 | ChEMBL |
| AG2037 | ChEMBL |