EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C20H19N3O |
| Net Charge | 0 |
| Average Mass | 413.499 |
| Monoisotopic Mass | 413.14093 |
| SMILES | COC1=CC(c2cc3ccccc3n2)=N/C1=C\c1nc(C)cc1C.CS(=O)(=O)O |
| InChI | InChI=1S/C20H19N3O.CH4O3S/c1-12-8-13(2)21-16(12)10-19-20(24-3)11-18(23-19)17-9-14-6-4-5-7-15(14)22-17;1-5(2,3)4/h4-11,21-22H,1-3H3;1H3,(H,2,3,4)/b19-10-; |
| InChIKey | ZFKXDVMHNXPEIY-PEZBNFGJSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obatoclax mesylate (CHEBI:752588) has role antifibrotic agent (CHEBI:233423) |
| obatoclax mesylate (CHEBI:752588) has role antineoplastic agent (CHEBI:35610) |
| obatoclax mesylate (CHEBI:752588) is a dipyrrins (CHEBI:36749) |
| Synonyms | Source |
|---|---|
| GX-15-070MS | ChEMBL |
| GX15-070MS | ChEMBL |
| Obatoclax mesilate | ChEMBL |
| Obatoclax mesylate | ChEMBL |
| Citations |
|---|