EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O4P.C22H23N5O.H3O4P |
| Net Charge | 0 |
| Average Mass | 569.448 |
| Monoisotopic Mass | 569.14405 |
| SMILES | CC1(C)CNc2cc(NC(=O)c3cccnc3NCc3ccncc3)ccc21.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C22H23N5O.2H3O4P/c1-22(2)14-26-19-12-16(5-6-18(19)22)27-21(28)17-4-3-9-24-20(17)25-13-15-7-10-23-11-8-15;2*1-5(2,3)4/h3-12,26H,13-14H2,1-2H3,(H,24,25)(H,27,28);2*(H3,1,2,3,4) |
| InChIKey | ONDPWWDPQDCQNJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| motesanib diphosphate (CHEBI:752587) has role antineoplastic agent (CHEBI:35610) |
| motesanib diphosphate (CHEBI:752587) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Motesanib diphosphate | ChEMBL |
| Motesanib phosphate | ChEMBL |
| Citations |
|---|