EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O5.C20H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 542.969 |
| Monoisotopic Mass | 542.16672 |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)[C@@H]1c1ccccc1Cl.O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C20H25ClN2O5.C4H6O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;5-2(4(8)9)1-3(6)7/h5-8,17,23H,4,9-11,22H2,1-3H3;2,5H,1H2,(H,6,7)(H,8,9)/t17-;2-/m00/s1 |
| InChIKey | ICLGPDCMPQYWIA-OSRSGTIQSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levamlodipine malate (CHEBI:752582) has functional parent tetracarboxylic acid (CHEBI:35742) |
| levamlodipine malate (CHEBI:752582) has role antihypertensive agent (CHEBI:35674) |
| levamlodipine malate (CHEBI:752582) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| Levamlodipine l-malate | ChEMBL |