EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C26H40Cl4N5O10PS |
| Net Charge | 0 |
| Average Mass | 823.945 |
| Monoisotopic Mass | 821.07544 |
| SMILES | Cl.N[C@@H](CCC(=O)N[C@@H](CS(=O)(=O)CCOP(=O)(N(CCCl)CCCl)N(CCCl)CCCl)C(=O)N[C@@H](C(=O)O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H40Cl4N5O10PS.ClH/c27-8-12-34(13-9-28)46(42,35(14-10-29)15-11-30)45-16-17-47(43,44)18-21(32-22(36)7-6-20(31)25(38)39)24(37)33-23(26(40)41)19-4-2-1-3-5-19;/h1-5,20-21,23H,6-18,31H2,(H,32,36)(H,33,37)(H,38,39)(H,40,41);1H/t20-,21-,23+;/m0./s1 |
| InChIKey | NECZZOFFLFZNHL-XVGZVFJZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| canfosfamide hydrochloride (CHEBI:752564) has role antineoplastic agent (CHEBI:35610) |
| canfosfamide hydrochloride (CHEBI:752564) is a oligopeptide (CHEBI:25676) |
| Synonyms | Source |
|---|---|
| Canfosfamidhydrochloride | ChEMBL |
| TER-286 | ChEMBL |
| TLK-286 | ChEMBL |
| Brand Name | Source |
|---|---|
| Telcyta | ChEMBL |