EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752562 - bifeprunox mesylate
| Formula | CH4O3S.C24H23N3O2 |
| Net Charge | 0 |
| Average Mass | 481.574 |
| Monoisotopic Mass | 481.16714 |
| SMILES | CS(=O)(=O)O.O=c1nc2cccc(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)c2o1 |
| InChI | InChI=1S/C24H23N3O2.CH4O3S/c28-24-25-21-10-5-11-22(23(21)29-24)27-14-12-26(13-15-27)17-18-6-4-9-20(16-18)19-7-2-1-3-8-19;1-5(2,3)4/h1-11,16H,12-15,17H2,(H,25,28);1H3,(H,2,3,4) |
| InChIKey | ONWKHSGOYGLGPO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bifeprunox mesylate (CHEBI:752562) is a N-arylpiperazine (CHEBI:46848) |
| Synonyms | Source |
|---|---|
| Bifeprunox mesilate | ChEMBL |
| Bifeprunox mesylate | ChEMBL |
| Bifeprunox methanesulfonate | ChEMBL |
| DU-127090 | ChEMBL |
| DU127090 | ChEMBL |