EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C25H27N3O4 |
| Net Charge | 0 |
| Average Mass | 469.969 |
| Monoisotopic Mass | 469.17683 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccccc1c2CCNC(C)C.Cl |
| InChI | InChI=1S/C25H27N3O4.ClH/c1-4-25(31)19-11-21-22-17(12-28(21)23(29)18(19)13-32-24(25)30)15(9-10-26-14(2)3)16-7-5-6-8-20(16)27-22;/h5-8,11,14,26,31H,4,9-10,12-13H2,1-3H3;1H/t25-;/m0./s1 |
| InChIKey | SJKBXKKZBKCHET-UQIIZPHYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| belotecan hydrochloride (CHEBI:752561) has role antineoplastic agent (CHEBI:35610) |
| belotecan hydrochloride (CHEBI:752561) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Synonym | Source |
|---|---|
| Belotecan hcl | ChEMBL |