EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl.C13H14NOS |
| Net Charge | 0 |
| Average Mass | 267.781 |
| Monoisotopic Mass | 267.04846 |
| SMILES | Cc1sc[n+](CC(=O)c2ccccc2)c1C.[Cl-] |
| InChI | InChI=1S/C13H14NOS.ClH/c1-10-11(2)16-9-14(10)8-13(15)12-6-4-3-5-7-12;/h3-7,9H,8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | MKOMESMZHZNBIZ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alagebrium chloride (CHEBI:752557) has role antihypertensive agent (CHEBI:35674) |
| alagebrium chloride (CHEBI:752557) has role cardiovascular drug (CHEBI:35554) |
| alagebrium chloride (CHEBI:752557) is a aromatic ketone (CHEBI:76224) |
| INNs | Source |
|---|---|
| alagebrium chloride | WHO MedNet |
| chlorure d'alagebrium | WHO MedNet |
| cloruro de alagebrio | WHO MedNet |
| Synonym | Source |
|---|---|
| ALT-711 | ChEMBL |