EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C24H28N4O6 |
| Net Charge | 0 |
| Average Mass | 504.971 |
| Monoisotopic Mass | 504.17756 |
| SMILES | Cl.N=C(N)c1ccc(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N2CCC(OCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C24H28N4O6.ClH/c25-22(26)16-3-5-17(6-4-16)23(32)27-20(13-15-1-7-18(29)8-2-15)24(33)28-11-9-19(10-12-28)34-14-21(30)31;/h1-8,19-20,29H,9-14H2,(H3,25,26)(H,27,32)(H,30,31);1H/t20-;/m0./s1 |
| InChIKey | YUWYXULCUNUQCG-BDQAORGHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamifiban hydrochloride (CHEBI:752541) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| Lamifiban hcl | ChEMBL |
| Lamifiban hydrochloride | ChEMBL |
| RO 44-9883/023 | ChEMBL |
| RO-44-9883/023 | ChEMBL |