EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30NO5.C7H7O3S |
| Net Charge | 0 |
| Average Mass | 511.637 |
| Monoisotopic Mass | 511.22399 |
| SMILES | CC[N+](CC)(CC)CCOC(=O)c1cc(OC)c(OC)c(OC)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H30NO5.C7H8O3S/c1-7-19(8-2,9-3)10-11-24-18(20)14-12-15(21-4)17(23-6)16(13-14)22-5;1-6-2-4-7(5-3-6)11(8,9)10/h12-13H,7-11H2,1-6H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | LZMHPQDAYHVLMG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| troxonium tosilate (CHEBI:752535) is a methoxybenzoic acid (CHEBI:25238) |
| INNs | Source |
|---|---|
| tosilate de troxonium | WHO MedNet |
| tosilato de troxonio | WHO MedNet |
| troxonium tosilate | WHO MedNet |
| Synonyms | Source |
|---|---|
| FWH-399 | ChEMBL |
| NSC-96643 | ChEMBL |
| Troxonium tosylate | ChEMBL |