EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752528 - lauryl isoquinolinium bromide
| Formula | Br.C21H32N |
| Net Charge | 0 |
| Average Mass | 378.398 |
| Monoisotopic Mass | 377.17181 |
| SMILES | CCCCCCCCCCCC[n+]1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C21H32N.BrH/c1-2-3-4-5-6-7-8-9-10-13-17-22-18-16-20-14-11-12-15-21(20)19-22;/h11-12,14-16,18-19H,2-10,13,17H2,1H3;1H/q+1;/p-1 |
| InChIKey | MSJLMQTXVKCUCD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lauryl isoquinolinium bromide (CHEBI:752528) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| Decelerine | ChEMBL |
| Isothan | ChEMBL |
| Lauryl isoquinolinium bromide | ChEMBL |
| NSC-20909 | ChEMBL |
| Citations |
|---|