EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N5O3 |
| Net Charge | 0 |
| Average Mass | 303.322 |
| Monoisotopic Mass | 303.13314 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cnc(N3CCNCC3)nc21 |
| InChI | InChI=1S/C14H17N5O3/c1-2-18-8-10(13(21)22)11(20)9-7-16-14(17-12(9)18)19-5-3-15-4-6-19/h7-8,15H,2-6H2,1H3,(H,21,22) |
| InChIKey | JOHZPMXAZQZXHR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipemidic acid (CHEBI:75250) has role antibacterial drug (CHEBI:36047) |
| pipemidic acid (CHEBI:75250) has role DNA synthesis inhibitor (CHEBI:59517) |
| pipemidic acid (CHEBI:75250) is a N-arylpiperazine (CHEBI:46848) |
| pipemidic acid (CHEBI:75250) is a amino acid (CHEBI:33709) |
| pipemidic acid (CHEBI:75250) is a monocarboxylic acid (CHEBI:25384) |
| pipemidic acid (CHEBI:75250) is a pyridopyrimidine (CHEBI:38932) |
| pipemidic acid (CHEBI:75250) is a quinolone antibiotic (CHEBI:86324) |
| IUPAC Name |
|---|
| -ethyl-5-oxo-2-(piperazin-1-yl)-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylic acid |
| INNs | Source |
|---|---|
| acide pipemidique | ChemIDplus |
| acido pipemidico | ChemIDplus |
| acidum pipemidicum | ChemIDplus |
| pipemidic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 5,8-Dihydro-8-ethyl-5-oxo-2-(1-piperazinyl)pyrido(2,3-d)pyrimidine-6-carboxylic acid | ChemIDplus |
| 8-Ethyl-5,8-dihydro-5-oxo-2-(1-piperazinyl)pyrido(2,3-d)pyrimidine-6-carboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1904 | VSDB |
| 2184 | DrugCentral |
| D08379 | KEGG DRUG |
| HMDB0041989 | HMDB |
| LSM-5267 | LINCS |
| Pipemidic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:626575 | Reaxys |
| CAS:51940-44-4 | ChemIDplus |
| CAS:51940-44-4 | KEGG DRUG |
| Citations |
|---|