EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:752489 - tropigline
| Formula | C13H21NO2 |
| Net Charge | 0 |
| Average Mass | 223.316 |
| Monoisotopic Mass | 223.15723 |
| SMILES | [H][C@]12CC[C@]([H])(C[C@H](OC(=O)/C(C)=C/C)C1)N2C |
| InChI | InChI=1S/C13H21NO2/c1-4-9(2)13(15)16-12-7-10-5-6-11(8-12)14(10)3/h4,10-12H,5-8H2,1-3H3/b9-4+/t10-,11+,12+ |
| InChIKey | UVHGSMZRSVGWDJ-LKQNJMEQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropigline (CHEBI:752489) is a tropane alkaloid (CHEBI:37332) |
| INNs | Source |
|---|---|
| tropiglina | WHO MedNet |
| tropigline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tigloyltropine | ChEMBL |
| Tropyl 2,3-dimethylacrylate | ChEMBL |
| Brand Name | Source |
|---|---|
| Tiglic acid 3.alpha.-tropanyl ester | ChEMBL |