EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClN3O6 |
| Net Charge | 0 |
| Average Mass | 367.745 |
| Monoisotopic Mass | 367.05711 |
| SMILES | CCOC(=O)C(=O)Nc1cc(C#N)cc(NC(=O)C(=O)OCC)c1Cl |
| InChI | InChI=1S/C15H14ClN3O6/c1-3-24-14(22)12(20)18-9-5-8(7-17)6-10(11(9)16)19-13(21)15(23)25-4-2/h5-6H,3-4H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | BNTAPIYHWPPFBW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lodoxamide ethyl (CHEBI:752468) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Lodoxamide diethyl ester | ChEMBL |
| Lodoxamide ethyl | ChEMBL |
| U-42,718 | ChEMBL |
| U-42718 | ChEMBL |
| Citations |
|---|