EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21Cl2N2O7P |
| Net Charge | 0 |
| Average Mass | 383.165 |
| Monoisotopic Mass | 382.04634 |
| SMILES | O=P(NCCCl)(NCCCl)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H21Cl2N2O7P/c11-1-3-13-22(19,14-4-2-12)21-10-9(18)8(17)7(16)6(5-15)20-10/h6-10,15-18H,1-5H2,(H2,13,14,19)/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | PSVUJBVBCOISSP-SPFKKGSWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glufosfamide (CHEBI:752456) has role antineoplastic agent (CHEBI:35610) |
| glufosfamide (CHEBI:752456) is a phosphoramidate ester (CHEBI:27577) |
| INNs | Source |
|---|---|
| glufosfamida | WHO MedNet |
| glufosfamide | WHO MedNet |
| Synonyms | Source |
|---|---|
| D 19575 | ChEMBL |
| D-19575 | ChEMBL |
| D19575 | ChEMBL |
| Glucosylifosfamide mustard | ChEMBL |