EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO5 |
| Net Charge | 0 |
| Average Mass | 333.384 |
| Monoisotopic Mass | 333.15762 |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](C)C(=O)N1c2ccccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H23NO5/c1-4-24-18(23)12(3)9-11(2)16(20)19-14-8-6-5-7-13(14)10-15(19)17(21)22/h5-8,11-12,15H,4,9-10H2,1-3H3,(H,21,22)/t11-,12-,15+/m1/s1 |
| InChIKey | NVXFXLSOGLFXKQ-JMSVASOKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentopril (CHEBI:752448) is a indolyl carboxylic acid (CHEBI:46867) |
| INN | Source |
|---|---|
| pentopril | WHO MedNet |
| Synonyms | Source |
|---|---|
| CGS 13945 | ChEMBL |
| CGS-13945 | ChEMBL |