EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C16H17N3O5.Na |
| Net Charge | 0 |
| Average Mass | 377.308 |
| Monoisotopic Mass | 377.09636 |
| SMILES | N[C@@H](CCC(=O)[O-])C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C16H19N3O5.2Na/c17-11(5-6-14(20)21)15(22)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12;;/h1-4,8,11,13,18H,5-7,17H2,(H,19,22)(H,20,21)(H,23,24);;/q;2*+1/p-2/t11-,13-;;/m0../s1 |
| InChIKey | GDLPAGOVHZLZEK-JBUFHSOLSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oglufanide disodium (CHEBI:752444) has role antineoplastic agent (CHEBI:35610) |
| oglufanide disodium (CHEBI:752444) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Glufanide disodium | ChEMBL |
| IM-862 | ChEMBL |
| IM862 | ChEMBL |
| Oglufanide disodium | ChEMBL |
| Oglufanide sodium | ChEMBL |