EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75244 - aklaviketone
| Formula | C22H18O8 |
| Net Charge | 0 |
| Average Mass | 410.378 |
| Monoisotopic Mass | 410.10017 |
| SMILES | CC[C@@]1(O)CC(=O)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H18O8/c1-3-22(29)8-13(24)15-10(17(22)21(28)30-2)7-11-16(20(15)27)19(26)14-9(18(11)25)5-4-6-12(14)23/h4-7,17,23,27,29H,3,8H2,1-2H3/t17-,22+/m0/s1 |
| InChIKey | MHAXMIHGEZOCTQ-HTAPYJJXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces galilaeus (ncbitaxon:33899) | - | PubMed (3165374) | Strain: S 383 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aklaviketone (CHEBI:75244) has role bacterial metabolite (CHEBI:76969) |
| aklaviketone (CHEBI:75244) is a p-quinones (CHEBI:25830) |
| aklaviketone (CHEBI:75244) is a carbopolycyclic compound (CHEBI:35294) |
| aklaviketone (CHEBI:75244) is a methyl ester (CHEBI:25248) |
| aklaviketone (CHEBI:75244) is a polyphenol (CHEBI:26195) |
| aklaviketone (CHEBI:75244) is a tertiary alcohol (CHEBI:26878) |
| aklaviketone (CHEBI:75244) is a tetracenequinones (CHEBI:51286) |
| aklaviketone (CHEBI:75244) is a tetracenomycin (CHEBI:48132) |
| aklaviketone (CHEBI:75244) is conjugate acid of aklaviketone(1−) (CHEBI:77994) |
| Incoming Relation(s) |
| aklaviketone(1−) (CHEBI:77994) is conjugate base of aklaviketone (CHEBI:75244) |
| IUPAC Name |
|---|
| methyl (1R,2R)-2-ethyl-2,5,7-trihydroxy-4,6,11-trioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate |
| Synonym | Source |
|---|---|
| S-383-Y | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4276730 | Reaxys |
| CAS:116235-59-7 | KEGG COMPOUND |
| CAS:116235-59-7 | ChemIDplus |
| Citations |
|---|