EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75244 - aklaviketone
| Formula | C22H18O8 |
| Net Charge | 0 |
| Average Mass | 410.378 |
| Monoisotopic Mass | 410.10017 |
| SMILES | CC[C@@]1(O)CC(=O)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H18O8/c1-3-22(29)8-13(24)15-10(17(22)21(28)30-2)7-11-16(20(15)27)19(26)14-9(18(11)25)5-4-6-12(14)23/h4-7,17,23,27,29H,3,8H2,1-2H3/t17-,22+/m0/s1 |
| InChIKey | MHAXMIHGEZOCTQ-HTAPYJJXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces galilaeus (ncbitaxon:33899) | - | PubMed (3165374) | Strain: S 383 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aklaviketone (CHEBI:75244) has role bacterial metabolite (CHEBI:76969) |
| aklaviketone (CHEBI:75244) is a p-quinones (CHEBI:25830) |
| aklaviketone (CHEBI:75244) is a carbopolycyclic compound (CHEBI:35294) |
| aklaviketone (CHEBI:75244) is a methyl ester (CHEBI:25248) |
| aklaviketone (CHEBI:75244) is a polyphenol (CHEBI:26195) |
| aklaviketone (CHEBI:75244) is a tertiary alcohol (CHEBI:26878) |
| aklaviketone (CHEBI:75244) is a tetracenequinones (CHEBI:51286) |
| aklaviketone (CHEBI:75244) is a tetracenomycin (CHEBI:48132) |
| aklaviketone (CHEBI:75244) is conjugate acid of aklaviketone(1−) (CHEBI:77994) |
| Incoming Relation(s) |
| aklaviketone(1−) (CHEBI:77994) is conjugate base of aklaviketone (CHEBI:75244) |
| IUPAC Name |
|---|
| methyl (1R,2R)-2-ethyl-2,5,7-trihydroxy-4,6,11-trioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate |
| Synonym | Source |
|---|---|
| S-383-Y | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4276730 | Reaxys |
| CAS:116235-59-7 | KEGG COMPOUND |
| CAS:116235-59-7 | ChemIDplus |
| Citations |
|---|