EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752403 - thiambutosine
| Formula | C19H25N3OS |
| Net Charge | 0 |
| Average Mass | 343.496 |
| Monoisotopic Mass | 343.17183 |
| SMILES | CCCCOc1ccc(NC(=S)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H25N3OS/c1-4-5-14-23-18-12-8-16(9-13-18)21-19(24)20-15-6-10-17(11-7-15)22(2)3/h6-13H,4-5,14H2,1-3H3,(H2,20,21,24) |
| InChIKey | JYCBKPOKWDDOOV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiambutosine (CHEBI:752403) is a thioureas (CHEBI:51276) |
| INNs | Source |
|---|---|
| thiambutosine | WHO MedNet |
| tiambutosina | WHO MedNet |
| Synonyms | Source |
|---|---|
| CIBA 1906 | ChEMBL |
| CIBA-1906 | ChEMBL |
| NSC-682 | ChEMBL |
| Citations |
|---|