EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752396 - tampramine fumarate
| Formula | C4H4O4.C23H24N4 |
| Net Charge | 0 |
| Average Mass | 472.545 |
| Monoisotopic Mass | 472.21106 |
| SMILES | CN(C)CCCN1c2ccccc2C(c2ccccc2)=Nc2cccnc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H24N4.C4H4O4/c1-26(2)16-9-17-27-21-14-7-6-12-19(21)22(18-10-4-3-5-11-18)25-20-13-8-15-24-23(20)27;5-3(6)1-2-4(7)8/h3-8,10-15H,9,16-17H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | USQAILMOWHOBTK-WLHGVMLRSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tampramine fumarate (CHEBI:752396) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Synonyms | Source |
|---|---|
| AHR-9377 | ChEMBL |
| Tampramine fumarate | ChEMBL |