EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O3 |
| Net Charge | 0 |
| Average Mass | 368.477 |
| Monoisotopic Mass | 368.20999 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(C)[C@]([H])(C4)[C@]3(NCCCCC)C=CC2=O |
| InChI | InChI=1S/C22H28N2O3/c1-3-4-5-11-23-22-9-8-16(26)20-21(22)10-12-24(2)17(22)13-14-6-7-15(25)19(27-20)18(14)21/h6-9,17,20,23,25H,3-5,10-13H2,1-2H3/t17-,20+,21+,22-/m1/s1 |
| InChIKey | NRPCWSUJMWEFOK-KDXIVRHGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentamorphone (CHEBI:752389) is a morphinane alkaloid (CHEBI:25418) |
| INNs | Source |
|---|---|
| pentamorfona | WHO MedNet |
| pentamorphone | WHO MedNet |
| Synonyms | Source |
|---|---|
| 14b-n-pentylaminomorphinone | ChEMBL |
| A-4492 | ChEMBL |
| RX-77989 | ChEMBL |
| RX77989 | ChEMBL |