EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C21H16N2 |
| Net Charge | 0 |
| Average Mass | 332.834 |
| Monoisotopic Mass | 332.10803 |
| SMILES | Cl.N=C(N)c1ccc(C=C2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C21H16N2.ClH/c22-21(23)15-11-9-14(10-12-15)13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20;/h1-13H,(H3,22,23);1H |
| InChIKey | INDZCVYWKNWKIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paranyline hydrochloride (CHEBI:752379) is a fluorenes (CHEBI:24059) |
| INN | Source |
|---|---|
| renyfoline | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-31297 | ChEMBL |
| Paranyline hcl | ChEMBL |
| Paranyline hydrochloride | ChEMBL |
| Renytoline hydrochloride | ChEMBL |