EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752377 - risocaine
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | CCCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6H,2,7,11H2,1H3 |
| InChIKey | NBFQYHKHPBMJJV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| risocaine (CHEBI:752377) is a benzoate ester (CHEBI:36054) |
| INNs | Source |
|---|---|
| risocaina | WHO MedNet |
| risocaine | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-23516 | ChEMBL |
| Propyl p-aminobenzoate | ChEMBL |