EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O4 |
| Net Charge | 0 |
| Average Mass | 402.575 |
| Monoisotopic Mass | 402.27701 |
| SMILES | [H][C@]12CC[C@]3(C)[C@](O)(CCC(=O)O)CC[C@@]3([H])[C@]1([H])[C@H](CCC)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C25H38O4/c1-4-5-16-14-17-15-18(26)6-10-23(17,2)19-7-11-24(3)20(22(16)19)8-12-25(24,29)13-9-21(27)28/h15-16,19-20,22,29H,4-14H2,1-3H3,(H,27,28)/t16-,19+,20+,22-,23+,24+,25-/m1/s1 |
| InChIKey | DNHCHRGCTVRAFT-JEHIOXJOSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxprenoate potassium (CHEBI:752374) has role androgen (CHEBI:50113) |
| oxprenoate potassium (CHEBI:752374) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| oxprenoate de potassium | WHO MedNet |
| oxprenoate potassium | WHO MedNet |
| oxprenoato de potasio | WHO MedNet |