EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO2 |
| Net Charge | 0 |
| Average Mass | 313.441 |
| Monoisotopic Mass | 313.20418 |
| SMILES | [H][C@@]12Cc3ccc(O)cc3[C@]3(CCCC[C@]31O)CCN2CC1CC1 |
| InChI | InChI=1S/C20H27NO2/c22-16-6-5-15-11-18-20(23)8-2-1-7-19(20,17(15)12-16)9-10-21(18)13-14-3-4-14/h5-6,12,14,18,22-23H,1-4,7-11,13H2/t18-,19+,20-/m1/s1 |
| InChIKey | STBZIDOIKQNFCQ-HSALFYBXSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxilorphan (CHEBI:752369) is a phenanthrenes (CHEBI:25961) |
| INNs | Source |
|---|---|
| oxilorfano | WHO MedNet |
| oxilorphan | WHO MedNet |
| oxilorphane | WHO MedNet |
| Synonym | Source |
|---|---|
| LEVO-BC-2605 | ChEMBL |
| Citations |
|---|