EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClFN2O4 |
| Net Charge | 0 |
| Average Mass | 264.640 |
| Monoisotopic Mass | 264.03131 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](F)[C@@H](CO)O2)cc1Cl |
| InChI | InChI=1S/C9H10ClFN2O4/c10-4-2-13(9(16)12-8(4)15)7-1-5(11)6(3-14)17-7/h2,5-7,14H,1,3H2,(H,12,15,16)/t5-,6+,7+/m0/s1 |
| InChIKey | WKVDSZYIGHLONN-RRKCRQDMSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raluridine (CHEBI:752368) has role anti-HIV agent (CHEBI:64946) |
| raluridine (CHEBI:752368) is a organohalogen compound (CHEBI:17792) |
| raluridine (CHEBI:752368) is a pyrimidines (CHEBI:39447) |
| Synonyms | Source |
|---|---|
| 935-U-83 | ChEMBL |
| 935U83 | ChEMBL |
| Raluridine | ChEMBL |
| Citations |
|---|