EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752355 - pirinidazole
| Formula | C10H10N4O2S |
| Net Charge | 0 |
| Average Mass | 250.283 |
| Monoisotopic Mass | 250.05245 |
| SMILES | Cn1c([N+](=O)[O-])cnc1CSc1ccccn1 |
| InChI | InChI=1S/C10H10N4O2S/c1-13-8(12-6-10(13)14(15)16)7-17-9-4-2-3-5-11-9/h2-6H,7H2,1H3 |
| InChIKey | IRVDBEMWNQAVEV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirinidazole (CHEBI:752355) is a C-nitro compound (CHEBI:35716) |
| pirinidazole (CHEBI:752355) is a imidazoles (CHEBI:24780) |
| INNs | Source |
|---|---|
| pirinidazol | WHO MedNet |
| pirinidazole | WHO MedNet |