EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C18H21NO3 |
| Net Charge | 0 |
| Average Mass | 335.831 |
| Monoisotopic Mass | 335.12882 |
| SMILES | Cl.[H][C@@]12CCC(=O)[C@]3(C)Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C18H21NO3.ClH/c1-17-14(21)6-4-11-12-9-10-3-5-13(20)16(22-17)15(10)18(11,17)7-8-19(12)2;/h3,5,11-12,20H,4,6-9H2,1-2H3;1H/t11-,12+,17-,18-;/m0./s1 |
| InChIKey | IUIZPWPENLRTFZ-RNWHKREASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metopon hydrochloride (CHEBI:752345) is a morphinane alkaloid (CHEBI:25418) |
| Synonym | Source |
|---|---|
| Methyldihydromorphinone hydrochloride | ChEMBL |