EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19ClN2O4 |
| Net Charge | 0 |
| Average Mass | 362.813 |
| Monoisotopic Mass | 362.10333 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H19ClN2O4/c1-18(2,25-15-7-5-14(19)6-8-15)17(23)24-11-10-21-16(22)13-4-3-9-20-12-13/h3-9,12H,10-11H2,1-2H3,(H,21,22) |
| InChIKey | MCECKJXCBZXVJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picafibrate (CHEBI:752340) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| picafibrate | WHO MedNet |
| picafibrato | WHO MedNet |