EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H19N5 |
| Net Charge | 0 |
| Average Mass | 185.275 |
| Monoisotopic Mass | 185.16405 |
| SMILES | CCCCCCNC(=N)NC(=N)N |
| InChI | InChI=1S/C8H19N5/c1-2-3-4-5-6-12-8(11)13-7(9)10/h2-6H2,1H3,(H6,9,10,11,12,13) |
| InChIKey | VAZJLPXFVQHDFB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polihexanide (CHEBI:752331) has role anti-inflammatory agent (CHEBI:67079) |
| polihexanide (CHEBI:752331) has role antifungal agent (CHEBI:35718) |
| polihexanide (CHEBI:752331) has role ophthalmology drug (CHEBI:66981) |
| polihexanide (CHEBI:752331) is a biguanides (CHEBI:53662) |
| Synonyms | Source |
|---|---|
| Cosmocil cq | ChEMBL |
| Lavasept | ChEMBL |
| Microcare mbg | ChEMBL |
| Polyhexamethylene biguanide | ChEMBL |
| Purista | ChEMBL |
| Vantocil | ChEMBL |
| Brand Name | Source |
|---|---|
| Akantior | ChEMBL |