EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C16H22N4 |
| Net Charge | 0 |
| Average Mass | 420.466 |
| Monoisotopic Mass | 420.20088 |
| SMILES | CN1CCC/C1=N\C(=N\c1ccccc1)N1CCCC1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C16H22N4.C4H6O6/c1-19-11-7-10-15(19)18-16(20-12-5-6-13-20)17-14-8-3-2-4-9-14;5-1(3(7)8)2(6)4(9)10/h2-4,8-9H,5-7,10-13H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/b17-16-,18-15+; |
| InChIKey | POCOFJTXQYWTDN-UIAJKVCXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirogliride tartrate (CHEBI:752330) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| MCN-3495 | ChEMBL |
| NSC-352123 | ChEMBL |
| Pirogliride tartrate | ChEMBL |