EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752306 - norcholestenol iodomethyl i-131
| Formula | C27H45O |
| Net Charge | 0 |
| Average Mass | 516.562 |
| Monoisotopic Mass | 516.25317 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@]1([H])C3=C(C[C@@H](O)CC3)[C@H](C[131I])C[C@@]21[H] |
| InChI | InChI=1S/C27H45IO/c1-17(2)6-5-7-18(3)25-10-11-26-24-14-19(16-28)23-15-20(29)8-9-21(23)22(24)12-13-27(25,26)4/h17-20,22,24-26,29H,5-16H2,1-4H3/t18-,19+,20+,22-,24-,25-,26+,27-/m1/s1/i28+4 |
| InChIKey | QJHZPCLORSPENH-DRTKWHMQSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norcholestenol iodomethyl i-131 (CHEBI:752306) is a cholestanoid (CHEBI:50401) |
| Synonyms | Source |
|---|---|
| Iodinated (131i) norcholesterol | ChEMBL |
| Iodine (131 i) norcholesterol | ChEMBL |
| Iodine (131i) norcholesterol | ChEMBL |
| Iodine norcholesterol (131i) | ChEMBL |
| Norcholestenol iodomethyl (131i) [injection] | ChEMBL |
| Norcholestenol iodomethyl i-131 | ChEMBL |