EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752304 - methylparaben sodium
| Formula | Na.C8H7O3 |
| Net Charge | 0 |
| Average Mass | 174.131 |
| Monoisotopic Mass | 174.02929 |
| SMILES | COC(=O)c1ccc([O-])cc1.[Na+] |
| InChI | InChI=1S/C8H8O3.Na/c1-11-8(10)6-2-4-7(9)5-3-6;/h2-5,9H,1H3;/q;+1/p-1 |
| InChIKey | PESXGULMKCKJCC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylparaben sodium (CHEBI:752304) is a benzoate ester (CHEBI:36054) |
| Synonyms | Source |
|---|---|
| Methylparaben sodium | ChEMBL |
| Nipagin m sodium | ChEMBL |
| Ns 3500s | ChEMBL |
| Paratexin ms | ChEMBL |
| Paridol mna | ChEMBL |
| Sodium methyl paraben | ChEMBL |