EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:752294 - rimoprogin
| Formula | C8H7IN2OS |
| Net Charge | 0 |
| Average Mass | 306.128 |
| Monoisotopic Mass | 305.93238 |
| SMILES | CSc1ncc(OCC#CI)cn1 |
| InChI | InChI=1S/C8H7IN2OS/c1-13-8-10-5-7(6-11-8)12-4-2-3-9/h5-6H,4H2,1H3 |
| InChIKey | AKZAGHOFDGJXCC-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rimoprogin (CHEBI:752294) is a aryl sulfide (CHEBI:35683) |
| INNs | Source |
|---|---|
| rimoprogin | WHO MedNet |
| rimoprogina | WHO MedNet |
| rimoprogine | WHO MedNet |