EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75228 - sodium lactate
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | CC(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | NGSFWBMYFKHRBD-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Biological Roles: | food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. antiviral agent A substance that destroys or inhibits replication of viruses. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. vulnerary A drug used in treating and healing of wounds. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium lactate (CHEBI:75228) has part lactate (CHEBI:24996) |
| sodium lactate (CHEBI:75228) has role antidepressant (CHEBI:35469) |
| sodium lactate (CHEBI:75228) has role antineoplastic agent (CHEBI:35610) |
| sodium lactate (CHEBI:75228) has role antiviral agent (CHEBI:22587) |
| sodium lactate (CHEBI:75228) has role cardiovascular drug (CHEBI:35554) |
| sodium lactate (CHEBI:75228) has role food acidity regulator (CHEBI:64049) |
| sodium lactate (CHEBI:75228) has role food preservative (CHEBI:65255) |
| sodium lactate (CHEBI:75228) has role gastrointestinal drug (CHEBI:55324) |
| sodium lactate (CHEBI:75228) has role ophthalmology drug (CHEBI:66981) |
| sodium lactate (CHEBI:75228) has role vulnerary (CHEBI:73336) |
| sodium lactate (CHEBI:75228) is a lactate salt (CHEBI:24997) |
| sodium lactate (CHEBI:75228) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-hydroxypropanoate |
| INNs | Source |
|---|---|
| compound solution of sodium lactate | WHO MedNet |
| solucion de lactato sodico compuesta | WHO MedNet |
| solute de lactate de sodium compose | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-Hydroxypropanoic acid, monosodium salt | ChemIDplus |
| E-325 | ChEMBL |
| E325 | ChEBI |
| INS-325 | ChEMBL |
| INS NO.325 | ChEMBL |
| Lactic acid, monosodium salt | ChemIDplus |
| Brand Names | Source |
|---|---|
| Mediject L | KEGG DRUG |
| Sod lact co | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D02183 | KEGG DRUG |
| Sodium_lactate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4332999 | Reaxys |
| CAS:72-17-3 | ChemIDplus |
| CAS:72-17-3 | KEGG DRUG |
| Citations |
|---|