EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75228 - sodium lactate
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | CC(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | NGSFWBMYFKHRBD-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. |
| Applications: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium lactate (CHEBI:75228) has part lactate (CHEBI:24996) |
| sodium lactate (CHEBI:75228) has role food acidity regulator (CHEBI:64049) |
| sodium lactate (CHEBI:75228) has role food preservative (CHEBI:65255) |
| sodium lactate (CHEBI:75228) is a lactate salt (CHEBI:24997) |
| sodium lactate (CHEBI:75228) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| Lactic acid sodium salt | ChemIDplus |
| Monosodium 2-hydroxypropanoate | ChemIDplus |
| 2-Hydroxypropanoic acid, monosodium salt | ChemIDplus |
| Sodium alpha-hydroxypropionate | ChemIDplus |
| Lactic acid, monosodium salt | ChemIDplus |
| Monosodium lactate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Mediject L | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02183 | KEGG DRUG |
| Sodium_lactate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4332999 | Reaxys |
| CAS:72-17-3 | KEGG DRUG |
| CAS:72-17-3 | ChemIDplus |
| Citations |
|---|