EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75228 - sodium lactate
| Formula | C3H5O3.Na |
| Net Charge | 0 |
| Average Mass | 112.060 |
| Monoisotopic Mass | 112.01364 |
| SMILES | CC(O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | NGSFWBMYFKHRBD-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Biological Roles: | food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Applications: | food preservative Substances which are added to food in order to prevent decomposition caused by microbial growth or by undesirable chemical changes. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium lactate (CHEBI:75228) has part lactate (CHEBI:24996) |
| sodium lactate (CHEBI:75228) has role food acidity regulator (CHEBI:64049) |
| sodium lactate (CHEBI:75228) has role food preservative (CHEBI:65255) |
| sodium lactate (CHEBI:75228) is a lactate salt (CHEBI:24997) |
| sodium lactate (CHEBI:75228) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-hydroxypropanoate |
| Synonyms | Source |
|---|---|
| 2-Hydroxypropanoic acid, monosodium salt | ChemIDplus |
| E325 | ChEBI |
| Lactic acid, monosodium salt | ChemIDplus |
| Lactic acid sodium salt | ChemIDplus |
| Monosodium 2-hydroxypropanoate | ChemIDplus |
| Monosodium lactate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Mediject L | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02183 | KEGG DRUG |
| Sodium_lactate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4332999 | Reaxys |
| CAS:72-17-3 | ChemIDplus |
| CAS:72-17-3 | KEGG DRUG |
| Citations |
|---|