EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O3 |
| Net Charge | 0 |
| Average Mass | 400.603 |
| Monoisotopic Mass | 400.29775 |
| SMILES | [H][C@@]12CC[C@@]3([H])[C@]4([H])CC[C@H](OC5(OC)CCCCC5)[C@@]4(C)CC[C@]3([H])[C@@]1(C)C=CC(=O)C2 |
| InChI | InChI=1S/C26H40O3/c1-24-15-11-19(27)17-18(24)7-8-20-21-9-10-23(25(21,2)16-12-22(20)24)29-26(28-3)13-5-4-6-14-26/h11,15,18,20-23H,4-10,12-14,16-17H2,1-3H3/t18-,20-,21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | AGGYYWICUTUTCC-NMTVEPIMSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesabolone (CHEBI:752277) has role androgen (CHEBI:50113) |
| mesabolone (CHEBI:752277) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| mesabolona | WHO MedNet |
| mesabolone | WHO MedNet |
| Synonym | Source |
|---|---|
| NSC-73871 | ChEMBL |